C31H37N3 — CID 131974038
3-(3-ethylphenyl)-5-(4-hexyl-2,6-dimethylphenyl)-4-(2-methylphenyl)-1,2,4-triazole (PubChem CID 131974038) has the molecular formula C31H37N3 and a molecular weight of 451.66 g/mol. Its IUPAC name is 3-(3-ethylphenyl)-5-(4-hexyl-2,6-dimethylphenyl)-4-(2-methylphenyl)-1,2,4-triazole.
| Compound Name | 3-(3-ethylphenyl)-5-(4-hexyl-2,6-dimethylphenyl)-4-(2-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131974038 |
| Molecular Formula | C31H37N3 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 3-(3-ethylphenyl)-5-(4-hexyl-2,6-dimethylphenyl)-4-(2-methylphenyl)-1,2,4-triazole |
| SMILES | CCCCCCc1cc(C)c(-c2nnc(-c3cccc(CC)c3)n2-c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C31H37N3/c1-6-8-9-10-15-26-19-23(4)29(24(5)20-26)31-33-32-30(27-17-13-16-25(7-2)21-27)34(31)28-18-12-11-14-22(28)3/h11-14,16-21H,6-10,15H2,1-5H3 |
| InChIKey | NIMDBLDQYKCPLW-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|