C24H26N8O5 — CID 131974649
N-[3-[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-cyclobutylpyridine-2-carboxamide (PubChem CID 131974649) has the molecular formula C24H26N8O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-[3-[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-cyclobutylpyridine-2-carboxamide.
| Compound Name | N-[3-[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-cyclobutylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 131974649 |
| Molecular Formula | C24H26N8O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[3-[6-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylcarbamoyl)oxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-cyclobutylpyridine-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CCN(C(=O)c4ccccn4)C4CCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26N8O5/c1-26-22(35)19-17(33)18(34)24(37-19)32-12-28-16-20(25)29-15(30-21(16)32)9-5-11-31(13-6-4-7-13)23(36)14-8-2-3-10-27-14/h2-3,8,10,12-13,17-19,24,33-34H,4,6-7,11H2,1H3,(H,26,35)(H2,25,29,30)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | XRKHQDSZIRXAHT-UAKAABGRSA-N |
| XLogP | -0.78 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|