C25H27N7O6 — CID 75311787
methyl N-[3-[6-amino-9-[5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-benzylcarbamate (PubChem CID 75311787) has the molecular formula C25H27N7O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is methyl N-[3-[6-amino-9-[5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-benzylcarbamate.
| Compound Name | methyl N-[3-[6-amino-9-[5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 75311787 |
| Molecular Formula | C25H27N7O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | methyl N-[3-[6-amino-9-[5-(cyclopropylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]prop-2-ynyl]-N-benzylcarbamate |
| SMILES | COC(=O)N(CC#Cc1nc(N)c2ncn(C3OC(C(=O)NC4CC4)C(O)C3O)c2n1)Cc1ccccc1 |
| InChI | InChI=1S/C25H27N7O6/c1-37-25(36)31(12-14-6-3-2-4-7-14)11-5-8-16-29-21(26)17-22(30-16)32(13-27-17)24-19(34)18(33)20(38-24)23(35)28-15-9-10-15/h2-4,6-7,13,15,18-20,24,33-34H,9-12H2,1H3,(H,28,35)(H2,26,29,30) |
| InChIKey | JOWXTMSPSIFEOB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|