C25H28N6O8 — CID 177498705
(2S,3S,4R,5R)-5-[6-amino-2-[3-(3,4,5-trimethoxyphenoxy)prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 177498705) has the molecular formula C25H28N6O8 and a molecular weight of 540.53 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[3-(3,4,5-trimethoxyphenoxy)prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[3-(3,4,5-trimethoxyphenoxy)prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 177498705 |
| Molecular Formula | C25H28N6O8 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[3-(3,4,5-trimethoxyphenoxy)prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | COc1cc(OCC#Cc2nc(N)c3ncn([C@@H]4O[C@H](C(=O)NC5CC5)[C@@H](O)[C@H]4O)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N6O8/c1-35-14-9-13(10-15(36-2)20(14)37-3)38-8-4-5-16-29-22(26)17-23(30-16)31(11-27-17)25-19(33)18(32)21(39-25)24(34)28-12-6-7-12/h9-12,18-19,21,25,32-33H,6-8H2,1-3H3,(H,28,34)(H2,26,29,30)/t18-,19+,21-,25+/m0/s1 |
| InChIKey | ZPLXLTNPTHTMIQ-KLGLLFHNSA-N |
| XLogP | -0.24 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|