C28H33N7O6 — CID 159136302
(2S,4S,5R)-5-[6-amino-2-[3-[methyl(4-phenylmethoxybutanoyl)amino]prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 159136302) has the molecular formula C28H33N7O6 and a molecular weight of 563.62 g/mol. Its IUPAC name is (2S,4S,5R)-5-[6-amino-2-[3-[methyl(4-phenylmethoxybutanoyl)amino]prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,4S,5R)-5-[6-amino-2-[3-[methyl(4-phenylmethoxybutanoyl)amino]prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 159136302 |
| Molecular Formula | C28H33N7O6 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | (2S,4S,5R)-5-[6-amino-2-[3-[methyl(4-phenylmethoxybutanoyl)amino]prop-1-ynyl]purin-9-yl]-N-cyclopropyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CN(CC#Cc1nc(N)c2ncn([C@@H]3O[C@H](C(=O)NC4CC4)C(O)[C@@H]3O)c2n1)C(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C28H33N7O6/c1-34(20(36)10-6-14-40-15-17-7-3-2-4-8-17)13-5-9-19-32-25(29)21-26(33-19)35(16-30-21)28-23(38)22(37)24(41-28)27(39)31-18-11-12-18/h2-4,7-8,16,18,22-24,28,37-38H,6,10-15H2,1H3,(H,31,39)(H2,29,32,33)/t22?,23-,24-,28+/m0/s1 |
| InChIKey | NDICJDQZSXOHPX-PILZJMABSA-N |
| XLogP | 0.11 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|