C4H4N4O2 — CID 131977054
1-(2H-tetrazol-5-yl)propane-1,2-dione (PubChem CID 131977054) has the molecular formula C4H4N4O2 and a molecular weight of 140.10 g/mol. Its IUPAC name is 1-(2H-tetrazol-5-yl)propane-1,2-dione.
| Compound Name | 1-(2H-tetrazol-5-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 131977054 |
| Molecular Formula | C4H4N4O2 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 1-(2H-tetrazol-5-yl)propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C4H4N4O2/c1-2(9)3(10)4-5-7-8-6-4/h1H3,(H,5,6,7,8) |
| InChIKey | HWXOBKFURNXCON-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|