C7H10N4O2 — CID 131977055
3,3-dimethyl-1-(2H-tetrazol-5-yl)butane-1,2-dione (PubChem CID 131977055) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2H-tetrazol-5-yl)butane-1,2-dione.
| Compound Name | 3,3-dimethyl-1-(2H-tetrazol-5-yl)butane-1,2-dione |
|---|---|
| PubChem CID | 131977055 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 3,3-dimethyl-1-(2H-tetrazol-5-yl)butane-1,2-dione |
| SMILES | CC(C)(C)C(=O)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C7H10N4O2/c1-7(2,3)5(13)4(12)6-8-10-11-9-6/h1-3H3,(H,8,9,10,11) |
| InChIKey | VWQLJMCHVIIHFU-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|