C8H14N4O — CID 137429439
4,4-dimethyl-1-(2H-tetrazol-5-yl)pentan-3-one (PubChem CID 137429439) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2H-tetrazol-5-yl)pentan-3-one.
| Compound Name | 4,4-dimethyl-1-(2H-tetrazol-5-yl)pentan-3-one |
|---|---|
| PubChem CID | 137429439 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4,4-dimethyl-1-(2H-tetrazol-5-yl)pentan-3-one |
| SMILES | CC(C)(C)C(=O)CCc1nn[nH]n1 |
| InChI | InChI=1S/C8H14N4O/c1-8(2,3)6(13)4-5-7-9-11-12-10-7/h4-5H2,1-3H3,(H,9,10,11,12) |
| InChIKey | BRVGZSLWMYCTFQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |