C13H24N4O — CID 123762078
4-ethyl-4,6,6-trimethyl-7-(2H-tetrazol-5-yl)heptan-2-one (PubChem CID 123762078) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-ethyl-4,6,6-trimethyl-7-(2H-tetrazol-5-yl)heptan-2-one.
| Compound Name | 4-ethyl-4,6,6-trimethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 123762078 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-ethyl-4,6,6-trimethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
| SMILES | CCC(C)(CC(C)=O)CC(C)(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C13H24N4O/c1-6-13(5,7-10(2)18)9-12(3,4)8-11-14-16-17-15-11/h6-9H2,1-5H3,(H,14,15,16,17) |
| InChIKey | SNPJONPEOQTBIU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |