C18H25NO4 — CID 131978417
(1S,4aS,8aS)-4a,8a-dihydroxy-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 131978417) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (1S,4aS,8aS)-4a,8a-dihydroxy-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1S,4aS,8aS)-4a,8a-dihydroxy-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 131978417 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (1S,4aS,8aS)-4a,8a-dihydroxy-1-[(4-methoxyphenyl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COc1ccc(C[C@@H]2N(C=O)CC[C@@]3(O)CCCC[C@]23O)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-23-15-6-4-14(5-7-15)12-16-18(22)9-3-2-8-17(18,21)10-11-19(16)13-20/h4-7,13,16,21-22H,2-3,8-12H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | ICQPXSOWFRCIOT-BZSNNMDCSA-N |
| XLogP | 1.50 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|