C19H27NO4 — CID 138548873
(1S,4aS,8aS)-4a,8a-dihydroxy-1-[2-(4-methoxyphenyl)ethyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 138548873) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (1S,4aS,8aS)-4a,8a-dihydroxy-1-[2-(4-methoxyphenyl)ethyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1S,4aS,8aS)-4a,8a-dihydroxy-1-[2-(4-methoxyphenyl)ethyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 138548873 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (1S,4aS,8aS)-4a,8a-dihydroxy-1-[2-(4-methoxyphenyl)ethyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COc1ccc(CC[C@@H]2N(C=O)CC[C@@]3(O)CCCC[C@]23O)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-24-16-7-4-15(5-8-16)6-9-17-19(23)11-3-2-10-18(19,22)12-13-20(17)14-21/h4-5,7-8,14,17,22-23H,2-3,6,9-13H2,1H3/t17-,18-,19-/m0/s1 |
| InChIKey | MVPVUEULADEOMG-FHWLQOOXSA-N |
| XLogP | 1.89 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|