C9H16F2N2O3 — CID 131979484
N-[1-[2-[(2-fluoroacetyl)amino]propoxy]propan-2-yl]carbamoyl fluoride (PubChem CID 131979484) has the molecular formula C9H16F2N2O3 and a molecular weight of 238.23 g/mol. Its IUPAC name is N-[1-[2-[(2-fluoroacetyl)amino]propoxy]propan-2-yl]carbamoyl fluoride.
| Compound Name | N-[1-[2-[(2-fluoroacetyl)amino]propoxy]propan-2-yl]carbamoyl fluoride |
|---|---|
| PubChem CID | 131979484 |
| Molecular Formula | C9H16F2N2O3 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N-[1-[2-[(2-fluoroacetyl)amino]propoxy]propan-2-yl]carbamoyl fluoride |
| SMILES | CC(COCC(C)NC(=O)CF)NC(=O)F |
| InChI | InChI=1S/C9H16F2N2O3/c1-6(12-8(14)3-10)4-16-5-7(2)13-9(11)15/h6-7H,3-5H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | OWBPNXUOIFDAFN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|