C11H13ClO3S — CID 131984023
7-chloro-6-methyl-4-methylsulfonyl-3,4-dihydro-2H-chromene (PubChem CID 131984023) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 7-chloro-6-methyl-4-methylsulfonyl-3,4-dihydro-2H-chromene.
| Compound Name | 7-chloro-6-methyl-4-methylsulfonyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 131984023 |
| Molecular Formula | C11H13ClO3S |
| Molecular Weight | 260.74 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 7-chloro-6-methyl-4-methylsulfonyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc2c(cc1Cl)OCCC2S(C)(=O)=O |
| InChI | InChI=1S/C11H13ClO3S/c1-7-5-8-10(6-9(7)12)15-4-3-11(8)16(2,13)14/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | OVLGXNRGPPXAGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |