C23H18Cl2N4O4S2 — CID 131984102
N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-1-methylsulfonyl-3,4-dihydro-2H-thieno[3,2-g]quinoxaline-7-carboxamide (PubChem CID 131984102) has the molecular formula C23H18Cl2N4O4S2 and a molecular weight of 549.46 g/mol. Its IUPAC name is N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-1-methylsulfonyl-3,4-dihydro-2H-thieno[3,2-g]quinoxaline-7-carboxamide.
| Compound Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-1-methylsulfonyl-3,4-dihydro-2H-thieno[3,2-g]quinoxaline-7-carboxamide |
|---|---|
| PubChem CID | 131984102 |
| Molecular Formula | C23H18Cl2N4O4S2 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-1-methylsulfonyl-3,4-dihydro-2H-thieno[3,2-g]quinoxaline-7-carboxamide |
| SMILES | CS(=O)(=O)N1CCNc2cc3sc(C(=O)Nc4cc(Cl)nc(Oc5ccc(Cl)cc5)c4)cc3cc21 |
| InChI | InChI=1S/C23H18Cl2N4O4S2/c1-35(31,32)29-7-6-26-17-12-19-13(8-18(17)29)9-20(34-19)23(30)27-15-10-21(25)28-22(11-15)33-16-4-2-14(24)3-5-16/h2-5,8-12,26H,6-7H2,1H3,(H,27,28,30) |
| InChIKey | JMNSDGUGNKLUEB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|