C24H18Cl2N2O4S2 — CID 131983884
N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-5-(1,1-dioxothiolan-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 131983884) has the molecular formula C24H18Cl2N2O4S2 and a molecular weight of 533.46 g/mol. Its IUPAC name is N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-5-(1,1-dioxothiolan-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-5-(1,1-dioxothiolan-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 131983884 |
| Molecular Formula | C24H18Cl2N2O4S2 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | N-[2-chloro-6-(4-chlorophenoxy)-4-pyridinyl]-5-(1,1-dioxothiolan-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)nc(Oc2ccc(Cl)cc2)c1)c1cc2cc(C3CCCS3(=O)=O)ccc2s1 |
| InChI | InChI=1S/C24H18Cl2N2O4S2/c25-16-4-6-18(7-5-16)32-23-13-17(12-22(26)28-23)27-24(29)20-11-15-10-14(3-8-19(15)33-20)21-2-1-9-34(21,30)31/h3-8,10-13,21H,1-2,9H2,(H,27,28,29) |
| InChIKey | WEPHGORAWFSVBT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|