C16H12Cl2N2O2S — CID 166642413
N'-(3,5-dichlorophenyl)-5-methoxy-1-benzothiophene-2-carbohydrazide (PubChem CID 166642413) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-5-methoxy-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-(3,5-dichlorophenyl)-5-methoxy-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 166642413 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-5-methoxy-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1ccc2sc(C(=O)NNc3cc(Cl)cc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c1-22-13-2-3-14-9(4-13)5-15(23-14)16(21)20-19-12-7-10(17)6-11(18)8-12/h2-8,19H,1H3,(H,20,21) |
| InChIKey | ZDJFIKFQLKJRBA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|