C17H18Cl2N2O — CID 2813076
4-tert-butyl-N'-(3,5-dichlorophenyl)benzohydrazide (PubChem CID 2813076) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 4-tert-butyl-N'-(3,5-dichlorophenyl)benzohydrazide.
| Compound Name | 4-tert-butyl-N'-(3,5-dichlorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 2813076 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-tert-butyl-N'-(3,5-dichlorophenyl)benzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O/c1-17(2,3)12-6-4-11(5-7-12)16(22)21-20-15-9-13(18)8-14(19)10-15/h4-10,20H,1-3H3,(H,21,22) |
| InChIKey | HXOQPDBCIZUPLU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|