C5H13ClN2O — CID 131984947
[(2S,3R)-2-methyloxolan-3-yl]hydrazine;hydrochloride (PubChem CID 131984947) has the molecular formula C5H13ClN2O and a molecular weight of 152.62 g/mol. Its IUPAC name is [(2S,3R)-2-methyloxolan-3-yl]hydrazine;hydrochloride.
| Compound Name | [(2S,3R)-2-methyloxolan-3-yl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 131984947 |
| Molecular Formula | C5H13ClN2O |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | [(2S,3R)-2-methyloxolan-3-yl]hydrazine;hydrochloride |
| SMILES | C[C@@H]1OCC[C@H]1NN.Cl |
| InChI | InChI=1S/C5H12N2O.ClH/c1-4-5(7-6)2-3-8-4;/h4-5,7H,2-3,6H2,1H3;1H/t4-,5+;/m0./s1 |
| InChIKey | IYWIDOVFKOJRDK-UYXJWNHNSA-N |
| XLogP | 0.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|