C26H25NOS — CID 131986306
(3S)-3-[4-[(3-cyclopentyl-1-benzothiophen-5-yl)methoxy]phenyl]hex-4-ynenitrile (PubChem CID 131986306) has the molecular formula C26H25NOS and a molecular weight of 399.56 g/mol. Its IUPAC name is (3S)-3-[4-[(3-cyclopentyl-1-benzothiophen-5-yl)methoxy]phenyl]hex-4-ynenitrile.
| Compound Name | (3S)-3-[4-[(3-cyclopentyl-1-benzothiophen-5-yl)methoxy]phenyl]hex-4-ynenitrile |
|---|---|
| PubChem CID | 131986306 |
| Molecular Formula | C26H25NOS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (3S)-3-[4-[(3-cyclopentyl-1-benzothiophen-5-yl)methoxy]phenyl]hex-4-ynenitrile |
| SMILES | CC#C[C@@H](CC#N)c1ccc(OCc2ccc3scc(C4CCCC4)c3c2)cc1 |
| InChI | InChI=1S/C26H25NOS/c1-2-5-20(14-15-27)21-9-11-23(12-10-21)28-17-19-8-13-26-24(16-19)25(18-29-26)22-6-3-4-7-22/h8-13,16,18,20,22H,3-4,6-7,14,17H2,1H3/t20-/m0/s1 |
| InChIKey | WSWFEMIUUTYWOM-FQEVSTJZSA-N |
| XLogP | 7.16 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|