C32H28F3NO3S — CID 131986165
(3S)-3-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynenitrile (PubChem CID 131986165) has the molecular formula C32H28F3NO3S and a molecular weight of 563.64 g/mol. Its IUPAC name is (3S)-3-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynenitrile.
| Compound Name | (3S)-3-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynenitrile |
|---|---|
| PubChem CID | 131986165 |
| Molecular Formula | C32H28F3NO3S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | (3S)-3-[4-[[3-[4-(2-methoxyethoxy)-2-methylphenyl]-2-(trifluoromethyl)-1-benzothiophen-5-yl]methoxy]phenyl]hex-4-ynenitrile |
| SMILES | CC#C[C@@H](CC#N)c1ccc(OCc2ccc3sc(C(F)(F)F)c(-c4ccc(OCCOC)cc4C)c3c2)cc1 |
| InChI | InChI=1S/C32H28F3NO3S/c1-4-5-23(14-15-36)24-7-9-25(10-8-24)39-20-22-6-13-29-28(19-22)30(31(40-29)32(33,34)35)27-12-11-26(18-21(27)2)38-17-16-37-3/h6-13,18-19,23H,14,16-17,20H2,1-3H3/t23-/m0/s1 |
| InChIKey | YURSBSRWPPZXDP-QHCPKHFHSA-N |
| XLogP | 8.52 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|