About carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid
carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid (PubChem CID 131986322) has the molecular formula C19H17FN2O6S
and a molecular weight of 420.42 g/mol. Its IUPAC name is carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid.
Molecular Properties
| Compound Name | carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid |
| PubChem CID | 131986322 |
| Molecular Formula | C19H17FN2O6S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid |
| SMILES | COc1ccc(-c2csc3c(F)cc(C(=O)NC(=O)O)cc23)c(C)c1.NC(=O)O |
| InChI | InChI=1S/C18H14FNO4S.CH3NO2/c1-9-5-11(24-2)3-4-12(9)14-8-25-16-13(14)6-10(7-15(16)19)17(21)20-18(22)23;2-1(3)4/h3-8H,1-2H3,(H,20,21)(H,22,23);2H2,(H,3,4) |
| InChIKey | NATKXUQGNKZLIN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid?
The IUPAC name of carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid (CID 131986322) is carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid.
What is the SMILES notation for carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid?
The canonical SMILES for carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid is COc1ccc(-c2csc3c(F)cc(C(=O)NC(=O)O)cc23)c(C)c1.NC(=O)O.
What is the InChIKey of carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid?
The InChIKey is NATKXUQGNKZLIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNO4S.CH3NO2/c1-9-5-11(24-2)3-4-12(9)14-8-25-16-13(14)6-10(7-15(16)19)17(21)20-18(22)23;2-1(3)4/h3-8H,1-2H3,(H,20,21)(H,22,23);2H2,(H,3,4).
What are the key properties of carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid?
carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid has a molecular weight of 420.42 g/mol, XLogP of 4.06, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;[7-fluoro-3-(4-methoxy-2-methylphenyl)-1-benzothiophene-5-carbonyl]carbamic acid is sourced from PubChem (CID 131986322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).