C28H32N8O7 — CID 131986663
4-[4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]butylamino]-3-methoxy-2-methyl-5-nitrobenzoic acid (PubChem CID 131986663) has the molecular formula C28H32N8O7 and a molecular weight of 592.61 g/mol. Its IUPAC name is 4-[4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]butylamino]-3-methoxy-2-methyl-5-nitrobenzoic acid.
| Compound Name | 4-[4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]butylamino]-3-methoxy-2-methyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 131986663 |
| Molecular Formula | C28H32N8O7 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 4-[4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]butylamino]-3-methoxy-2-methyl-5-nitrobenzoic acid |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)ccc2n1CCCCNc1c([N+](=O)[O-])cc(C(=O)O)c(C)c1OC |
| InChI | InChI=1S/C28H32N8O7/c1-5-35-22(12-15(2)33-35)26(38)32-28-31-19-13-17(25(29)37)8-9-20(19)34(28)11-7-6-10-30-23-21(36(41)42)14-18(27(39)40)16(3)24(23)43-4/h8-9,12-14,30H,5-7,10-11H2,1-4H3,(H2,29,37)(H,39,40)(H,31,32,38) |
| InChIKey | GZFKTZLKVHZEBE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 209.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|