butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate

C12H21F2NO3 — CID 131987268

IUPACbutyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate
SMILESCCCCOC(=O)N1CCC(CCO)C(F)(F)C1
InChIInChI=1S/C12H21F2NO3/c1-2-3-8-18-11(17)15-6-4-10(5-7-16)12(13,14)9-15/h10,16H,2-9H2,1H3
InChIKeyQDEJMMDMGGMBBD-UHFFFAOYSA-N
MW265.30 g/mol
LogP2.26
Rot. Bonds5

About butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate

butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 131987268) has the molecular formula C12H21F2NO3 and a molecular weight of 265.30 g/mol. Its IUPAC name is butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate.

Molecular Properties

Compound Namebutyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate
PubChem CID131987268
Molecular FormulaC12H21F2NO3
Molecular Weight265.30 g/mol
Exact Mass265.15
IUPAC Namebutyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate
SMILESCCCCOC(=O)N1CCC(CCO)C(F)(F)C1
InChIInChI=1S/C12H21F2NO3/c1-2-3-8-18-11(17)15-6-4-10(5-7-16)12(13,14)9-15/h10,16H,2-9H2,1H3
InChIKeyQDEJMMDMGGMBBD-UHFFFAOYSA-N
XLogP2.26
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.30
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate?
The IUPAC name of butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate (CID 131987268) is butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate.
What is the SMILES notation for butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate?
The canonical SMILES for butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate is CCCCOC(=O)N1CCC(CCO)C(F)(F)C1.
What is the InChIKey of butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate?
The InChIKey is QDEJMMDMGGMBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO3/c1-2-3-8-18-11(17)15-6-4-10(5-7-16)12(13,14)9-15/h10,16H,2-9H2,1H3.
What are the key properties of butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate?
butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate has a molecular weight of 265.30 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate is sourced from PubChem (CID 131987268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).