C12H21F2NO3 — CID 131987268
butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate (PubChem CID 131987268) has the molecular formula C12H21F2NO3 and a molecular weight of 265.30 g/mol. Its IUPAC name is butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate.
| Compound Name | butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131987268 |
| Molecular Formula | C12H21F2NO3 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | butyl 3,3-difluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(CCO)C(F)(F)C1 |
| InChI | InChI=1S/C12H21F2NO3/c1-2-3-8-18-11(17)15-6-4-10(5-7-16)12(13,14)9-15/h10,16H,2-9H2,1H3 |
| InChIKey | QDEJMMDMGGMBBD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|