C13H22F2N2O2 — CID 175978607
butyl 3-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate (PubChem CID 175978607) has the molecular formula C13H22F2N2O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is butyl 3-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate.
| Compound Name | butyl 3-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175978607 |
| Molecular Formula | C13H22F2N2O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | butyl 3-(3,3-difluoroazetidin-1-yl)piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(N2CC(F)(F)C2)C1 |
| InChI | InChI=1S/C13H22F2N2O2/c1-2-3-7-19-12(18)16-6-4-5-11(8-16)17-9-13(14,15)10-17/h11H,2-10H2,1H3 |
| InChIKey | QNDRMCQZNLZVOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|