C20H24F3N6O2+ — CID 131992265
4-[(4-hydroxy-4-methylcyclohexyl)amino]-2-[[1-hydroxy-6-methyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 131992265) has the molecular formula C20H24F3N6O2+ and a molecular weight of 437.45 g/mol. Its IUPAC name is 4-[(4-hydroxy-4-methylcyclohexyl)amino]-2-[[1-hydroxy-6-methyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[(4-hydroxy-4-methylcyclohexyl)amino]-2-[[1-hydroxy-6-methyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 131992265 |
| Molecular Formula | C20H24F3N6O2+ |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 4-[(4-hydroxy-4-methylcyclohexyl)amino]-2-[[1-hydroxy-6-methyl-4-(trifluoromethyl)pyridin-1-ium-3-yl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(C(F)(F)F)c(CNc2ncc(C#N)c(NC3CCC(C)(O)CC3)n2)c[n+]1O |
| InChI | InChI=1S/C20H24F3N6O2/c1-12-7-16(20(21,22)23)14(11-29(12)31)10-26-18-25-9-13(8-24)17(28-18)27-15-3-5-19(2,30)6-4-15/h7,9,11,15,30-31H,3-6,10H2,1-2H3,(H2,25,26,27,28)/q+1 |
| InChIKey | SWZRTZAMWMCFGN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|