C52H33N4OP — CID 131994018
5-(8a,10c-dihydropyren-1-yl)-2-[(4-phenylphenyl)-(5-pyren-1-ylpyrimidin-2-yl)phosphoryl]pyrimidine (PubChem CID 131994018) has the molecular formula C52H33N4OP and a molecular weight of 760.84 g/mol. Its IUPAC name is 5-(8a,10c-dihydropyren-1-yl)-2-[(4-phenylphenyl)-(5-pyren-1-ylpyrimidin-2-yl)phosphoryl]pyrimidine.
| Compound Name | 5-(8a,10c-dihydropyren-1-yl)-2-[(4-phenylphenyl)-(5-pyren-1-ylpyrimidin-2-yl)phosphoryl]pyrimidine |
|---|---|
| PubChem CID | 131994018 |
| Molecular Formula | C52H33N4OP |
| Molecular Weight | 760.84 g/mol |
| Exact Mass | 760.24 |
| IUPAC Name | 5-(8a,10c-dihydropyren-1-yl)-2-[(4-phenylphenyl)-(5-pyren-1-ylpyrimidin-2-yl)phosphoryl]pyrimidine |
| SMILES | O=P(c1ccc(-c2ccccc2)cc1)(c1ncc(-c2ccc3c4c2C=CC2C=CC=C(C=C3)C42)cn1)c1ncc(-c2ccc3ccc4cccc5ccc2c3c45)cn1 |
| InChI | InChI=1S/C52H33N4OP/c57-58(42-22-16-33(17-23-42)32-6-2-1-3-7-32,51-53-28-40(29-54-51)43-24-18-38-14-12-34-8-4-10-36-20-26-45(43)49(38)47(34)36)52-55-30-41(31-56-52)44-25-19-39-15-13-35-9-5-11-37-21-27-46(44)50(39)48(35)37/h1-31,36,47H |
| InChIKey | WQIVRXUNOXPEFT-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.84 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|