C20H23FN4 — CID 131995639
1-(5-cyclopropyl-2-pyridinyl)-4-[1-(6-fluoro-4-methyl-3-pyridinyl)ethenyl]piperazine (PubChem CID 131995639) has the molecular formula C20H23FN4 and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(5-cyclopropyl-2-pyridinyl)-4-[1-(6-fluoro-4-methyl-3-pyridinyl)ethenyl]piperazine.
| Compound Name | 1-(5-cyclopropyl-2-pyridinyl)-4-[1-(6-fluoro-4-methyl-3-pyridinyl)ethenyl]piperazine |
|---|---|
| PubChem CID | 131995639 |
| Molecular Formula | C20H23FN4 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-(5-cyclopropyl-2-pyridinyl)-4-[1-(6-fluoro-4-methyl-3-pyridinyl)ethenyl]piperazine |
| SMILES | C=C(c1cnc(F)cc1C)N1CCN(c2ccc(C3CC3)cn2)CC1 |
| InChI | InChI=1S/C20H23FN4/c1-14-11-19(21)22-13-18(14)15(2)24-7-9-25(10-8-24)20-6-5-17(12-23-20)16-3-4-16/h5-6,11-13,16H,2-4,7-10H2,1H3 |
| InChIKey | PAARGWDVIPZYDP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|