C7H14N2O2 — CID 131996162
3-[(2R,4R)-4-amino-1-methylpyrrolidin-2-yl]oxiran-2-ol (PubChem CID 131996162) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-[(2R,4R)-4-amino-1-methylpyrrolidin-2-yl]oxiran-2-ol.
| Compound Name | 3-[(2R,4R)-4-amino-1-methylpyrrolidin-2-yl]oxiran-2-ol |
|---|---|
| PubChem CID | 131996162 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 3-[(2R,4R)-4-amino-1-methylpyrrolidin-2-yl]oxiran-2-ol |
| SMILES | CN1C[C@H](N)C[C@@H]1C1OC1O |
| InChI | InChI=1S/C7H14N2O2/c1-9-3-4(8)2-5(9)6-7(10)11-6/h4-7,10H,2-3,8H2,1H3/t4-,5-,6?,7?/m1/s1 |
| InChIKey | PVQJHGBKEITATP-HCRKAXIXSA-N |
| XLogP | -1.26 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|