C8H16N2O5 — CID 154732192
3,7-diamino-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2,4,6-triol (PubChem CID 154732192) has the molecular formula C8H16N2O5 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3,7-diamino-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2,4,6-triol.
| Compound Name | 3,7-diamino-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2,4,6-triol |
|---|---|
| PubChem CID | 154732192 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3,7-diamino-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2,4,6-triol |
| SMILES | NC1CC2OC(O)C(N)C(O)C2OC1O |
| InChI | InChI=1S/C8H16N2O5/c9-2-1-3-6(15-7(2)12)5(11)4(10)8(13)14-3/h2-8,11-13H,1,9-10H2 |
| InChIKey | SXFAKEJHUGQLQF-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |