C9H17NO5 — CID 57042539
(4aR,7R,8R,8aS)-7-amino-2-(deuteriomethyl)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol (PubChem CID 57042539) has the molecular formula C9H17NO5 and a molecular weight of 220.24 g/mol. Its IUPAC name is (4aR,7R,8R,8aS)-7-amino-2-(deuteriomethyl)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol.
| Compound Name | (4aR,7R,8R,8aS)-7-amino-2-(deuteriomethyl)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol |
|---|---|
| PubChem CID | 57042539 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (4aR,7R,8R,8aS)-7-amino-2-(deuteriomethyl)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,8-diol |
| SMILES | [2H]CC1(C)OC[C@H]2OC(O)[C@H](N)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C9H17NO5/c1-9(2)13-3-4-7(15-9)6(11)5(10)8(12)14-4/h4-8,11-12H,3,10H2,1-2H3/t4-,5-,6-,7-,8?/m1/s1/i1D/t4-,5-,6-,7-,8?,9? |
| InChIKey | DYWXBAKYSNMJEV-VSIQRQEUSA-N |
| XLogP | -1.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |