C20H40F2O2 — CID 131996565
2,2-difluoro-3,6-dimethyl-1,8-bis(3-methylbutoxy)octane (PubChem CID 131996565) has the molecular formula C20H40F2O2 and a molecular weight of 350.53 g/mol. Its IUPAC name is 2,2-difluoro-3,6-dimethyl-1,8-bis(3-methylbutoxy)octane.
| Compound Name | 2,2-difluoro-3,6-dimethyl-1,8-bis(3-methylbutoxy)octane |
|---|---|
| PubChem CID | 131996565 |
| Molecular Formula | C20H40F2O2 |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 2,2-difluoro-3,6-dimethyl-1,8-bis(3-methylbutoxy)octane |
| SMILES | CC(C)CCOCCC(C)CCC(C)C(F)(F)COCCC(C)C |
| InChI | InChI=1S/C20H40F2O2/c1-16(2)9-12-23-14-11-18(5)7-8-19(6)20(21,22)15-24-13-10-17(3)4/h16-19H,7-15H2,1-6H3 |
| InChIKey | GZMZRZUEXNFDDX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|