C32H46O4 — CID 131999471
benzyl 4-[(3R,6E,7S,10R,13R,17S)-6-ethylidene-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 131999471) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is benzyl 4-[(3R,6E,7S,10R,13R,17S)-6-ethylidene-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | benzyl 4-[(3R,6E,7S,10R,13R,17S)-6-ethylidene-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 131999471 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | benzyl 4-[(3R,6E,7S,10R,13R,17S)-6-ethylidene-3,7-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | C/C=C1/C(O)C2C(CC[C@@]3(C)C2CC[C@@H]3CCCC(=O)OCc2ccccc2)[C@@]2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C32H46O4/c1-4-24-27-19-23(33)15-17-32(27,3)26-16-18-31(2)22(13-14-25(31)29(26)30(24)35)11-8-12-28(34)36-20-21-9-6-5-7-10-21/h4-7,9-10,22-23,25-27,29-30,33,35H,8,11-20H2,1-3H3/b24-4+/t22-,23+,25?,26?,27?,29?,30?,31+,32+/m0/s1 |
| InChIKey | FREDHGMLHZSFPC-NHBAXODQSA-N |
| XLogP | 6.45 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|