C26H44O2 — CID 149478068
(3R,7S,10R,13R,17R)-6-ethylidene-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7-diol (PubChem CID 149478068) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is (3R,7S,10R,13R,17R)-6-ethylidene-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3R,7S,10R,13R,17R)-6-ethylidene-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 149478068 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | (3R,7S,10R,13R,17R)-6-ethylidene-10,13-dimethyl-17-[(2R)-pentan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,7-diol |
| SMILES | CC=C1C(O)C2C(CC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCC)[C@@]2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C26H44O2/c1-6-8-16(3)19-9-10-20-23-21(12-14-25(19,20)4)26(5)13-11-17(27)15-22(26)18(7-2)24(23)28/h7,16-17,19-24,27-28H,6,8-15H2,1-5H3/t16-,17-,19-,20?,21?,22?,23?,24?,25-,26-/m1/s1 |
| InChIKey | ZCRUNEAQOQSXKH-GSCRCKGBSA-N |
| XLogP | 5.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|