C51H61Cl2N7O9 — CID 131999771
CID 131999771 (PubChem CID 131999771) has the molecular formula C51H61Cl2N7O9 and a molecular weight of 986.99 g/mol.
| Compound Name | CID 131999771 |
|---|---|
| PubChem CID | 131999771 |
| Molecular Formula | C51H61Cl2N7O9 |
| Molecular Weight | 986.99 g/mol |
| Exact Mass | 985.39 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(NCCOCCOCCOCCNC(=O)C4CCC(NC(=O)[C@@H]5NC6(CCCCC6)[C@@]6(C(=O)Nc7cc(Cl)ccc76)[C@H]5c5cccc(Cl)c5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C51H61Cl2N7O9/c52-33-7-4-6-32(28-33)43-44(59-50(18-2-1-3-19-50)51(43)38-15-12-34(53)29-40(38)57-49(51)66)47(64)56-35-13-10-31(11-14-35)45(62)55-21-23-68-25-27-69-26-24-67-22-20-54-39-9-5-8-36-37(39)30-60(48(36)65)41-16-17-42(61)58-46(41)63/h4-9,12,15,28-29,31,35,41,43-44,54,59H,1-3,10-11,13-14,16-27,30H2,(H,55,62)(H,56,64)(H,57,66)(H,58,61,63)/t31?,35?,41?,43-,44+,51+/m0/s1 |
| InChIKey | DKKACOXLRLQJDD-YNZYZPCJSA-N |
| XLogP | 5.36 |
| TPSA | 205.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.99 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|