C12H22O2 — CID 13203877
(2E,4E)-1-(1-butoxyethoxy)hexa-2,4-diene (PubChem CID 13203877) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2E,4E)-1-(1-butoxyethoxy)hexa-2,4-diene.
| Compound Name | (2E,4E)-1-(1-butoxyethoxy)hexa-2,4-diene |
|---|---|
| PubChem CID | 13203877 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2E,4E)-1-(1-butoxyethoxy)hexa-2,4-diene |
| SMILES | C/C=C/C=C/COC(C)OCCCC |
| InChI | InChI=1S/C12H22O2/c1-4-6-8-9-11-14-12(3)13-10-7-5-2/h4,6,8-9,12H,5,7,10-11H2,1-3H3/b6-4+,9-8+ |
| InChIKey | ZCYVABZFWDUIQB-ICNYKPIKSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|