C14H20O6S4 — CID 13205373
1,2,2-tris(ethylsulfonyl)ethenylsulfanylbenzene (PubChem CID 13205373) has the molecular formula C14H20O6S4 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1,2,2-tris(ethylsulfonyl)ethenylsulfanylbenzene.
| Compound Name | 1,2,2-tris(ethylsulfonyl)ethenylsulfanylbenzene |
|---|---|
| PubChem CID | 13205373 |
| Molecular Formula | C14H20O6S4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1,2,2-tris(ethylsulfonyl)ethenylsulfanylbenzene |
| SMILES | CCS(=O)(=O)C(Sc1ccccc1)=C(S(=O)(=O)CC)S(=O)(=O)CC |
| InChI | InChI=1S/C14H20O6S4/c1-4-22(15,16)13(21-12-10-8-7-9-11-12)14(23(17,18)5-2)24(19,20)6-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | PCYWTCJKDYKMJF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |