C11H18O — CID 13208451
4-(1-methoxyethenyl)-1,2-dimethylcyclohexene (PubChem CID 13208451) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is 4-(1-methoxyethenyl)-1,2-dimethylcyclohexene.
| Compound Name | 4-(1-methoxyethenyl)-1,2-dimethylcyclohexene |
|---|---|
| PubChem CID | 13208451 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 4-(1-methoxyethenyl)-1,2-dimethylcyclohexene |
| SMILES | C=C(OC)C1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C11H18O/c1-8-5-6-11(7-9(8)2)10(3)12-4/h11H,3,5-7H2,1-2,4H3 |
| InChIKey | OROCYYYUFONKJA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|