C15H20N2O6 — CID 13209079
methyl 2-(N-(2-methoxyacetyl)-2,6-dimethyl-3-nitroanilino)propanoate (PubChem CID 13209079) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is methyl 2-(N-(2-methoxyacetyl)-2,6-dimethyl-3-nitroanilino)propanoate.
| Compound Name | methyl 2-(N-(2-methoxyacetyl)-2,6-dimethyl-3-nitroanilino)propanoate |
|---|---|
| PubChem CID | 13209079 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | methyl 2-(N-(2-methoxyacetyl)-2,6-dimethyl-3-nitroanilino)propanoate |
| SMILES | COCC(=O)N(c1c(C)ccc([N+](=O)[O-])c1C)C(C)C(=O)OC |
| InChI | InChI=1S/C15H20N2O6/c1-9-6-7-12(17(20)21)10(2)14(9)16(13(18)8-22-4)11(3)15(19)23-5/h6-7,11H,8H2,1-5H3 |
| InChIKey | WMEKCGHWVZTRJU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|