C14H16ClN3 — CID 13209291
(E)-3-(2-chlorophenyl)-N-cyano-N'-(2-methylpropyl)prop-2-enimidamide (PubChem CID 13209291) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-cyano-N'-(2-methylpropyl)prop-2-enimidamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-cyano-N'-(2-methylpropyl)prop-2-enimidamide |
|---|---|
| PubChem CID | 13209291 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-cyano-N'-(2-methylpropyl)prop-2-enimidamide |
| SMILES | CC(C)C/N=C(/C=C/c1ccccc1Cl)NC#N |
| InChI | InChI=1S/C14H16ClN3/c1-11(2)9-17-14(18-10-16)8-7-12-5-3-4-6-13(12)15/h3-8,11H,9H2,1-2H3,(H,17,18)/b8-7+ |
| InChIKey | FABMEELZRQHGOL-BQYQJAHWSA-N |
| XLogP | 3.48 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|