C11H7F6NO4S — CID 1321020
2,2,2-trifluoroethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate (PubChem CID 1321020) has the molecular formula C11H7F6NO4S and a molecular weight of 363.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 1321020 |
| Molecular Formula | C11H7F6NO4S |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetate |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(F)(F)F |
| InChI | InChI=1S/C11H7F6NO4S/c12-10(13,14)5-22-9(19)4-23-8-2-1-6(11(15,16)17)3-7(8)18(20)21/h1-3H,4-5H2 |
| InChIKey | KFNKBMGRJNFBJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|