C21H35N5O2 — CID 13210625
3-[3-(diethylamino)propylamino]-1-(3-morpholin-4-ylpropyl)indazol-5-ol (PubChem CID 13210625) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[3-(diethylamino)propylamino]-1-(3-morpholin-4-ylpropyl)indazol-5-ol.
| Compound Name | 3-[3-(diethylamino)propylamino]-1-(3-morpholin-4-ylpropyl)indazol-5-ol |
|---|---|
| PubChem CID | 13210625 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 3-[3-(diethylamino)propylamino]-1-(3-morpholin-4-ylpropyl)indazol-5-ol |
| SMILES | CCN(CC)CCCNc1nn(CCCN2CCOCC2)c2ccc(O)cc12 |
| InChI | InChI=1S/C21H35N5O2/c1-3-24(4-2)10-5-9-22-21-19-17-18(27)7-8-20(19)26(23-21)12-6-11-25-13-15-28-16-14-25/h7-8,17,27H,3-6,9-16H2,1-2H3,(H,22,23) |
| InChIKey | VSAIODPYKTWOPS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|