C13H5I4NO3 — CID 13211644
2-(furan-2-ylmethyl)-4,5,6,7-tetraiodoisoindole-1,3-dione (PubChem CID 13211644) has the molecular formula C13H5I4NO3 and a molecular weight of 730.80 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-4,5,6,7-tetraiodoisoindole-1,3-dione.
| Compound Name | 2-(furan-2-ylmethyl)-4,5,6,7-tetraiodoisoindole-1,3-dione |
|---|---|
| PubChem CID | 13211644 |
| Molecular Formula | C13H5I4NO3 |
| Molecular Weight | 730.80 g/mol |
| Exact Mass | 730.64 |
| IUPAC Name | 2-(furan-2-ylmethyl)-4,5,6,7-tetraiodoisoindole-1,3-dione |
| SMILES | O=C1c2c(I)c(I)c(I)c(I)c2C(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C13H5I4NO3/c14-8-6-7(9(15)11(17)10(8)16)13(20)18(12(6)19)4-5-2-1-3-21-5/h1-3H,4H2 |
| InChIKey | GLOFSXIHRVKPRR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|