C9H16S — CID 13212214
1,5,5-trimethyl-3-thiabicyclo[4.1.0]heptane (PubChem CID 13212214) has the molecular formula C9H16S and a molecular weight of 156.29 g/mol. Its IUPAC name is 1,5,5-trimethyl-3-thiabicyclo[4.1.0]heptane.
| Compound Name | 1,5,5-trimethyl-3-thiabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 13212214 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1,5,5-trimethyl-3-thiabicyclo[4.1.0]heptane |
| SMILES | CC1(C)CSCC2(C)CC12 |
| InChI | InChI=1S/C9H16S/c1-8(2)5-10-6-9(3)4-7(8)9/h7H,4-6H2,1-3H3 |
| InChIKey | HLBDTNFDBHNLIZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |