About sodium 4-nitrophenolate
sodium 4-nitrophenolate (PubChem CID 13214) has the molecular formula C6H4NNaO3
and a molecular weight of 161.09 g/mol. Its IUPAC name is sodium 4-nitrophenolate.
Molecular Properties
| Compound Name | sodium 4-nitrophenolate |
| PubChem CID | 13214 |
| Molecular Formula | C6H4NNaO3 |
| Molecular Weight | 161.09 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | sodium 4-nitrophenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1 |
| InChIKey | CURNJKLCYZZBNJ-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.09 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-nitrophenolate?
The IUPAC name of sodium 4-nitrophenolate (CID 13214) is sodium 4-nitrophenolate.
What is the SMILES notation for sodium 4-nitrophenolate?
The canonical SMILES for sodium 4-nitrophenolate is O=[N+]([O-])c1ccc([O-])cc1.[Na+].
What is the InChIKey of sodium 4-nitrophenolate?
The InChIKey is CURNJKLCYZZBNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1.
What are the key properties of sodium 4-nitrophenolate?
sodium 4-nitrophenolate has a molecular weight of 161.09 g/mol, XLogP of -2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-nitrophenolate is sourced from PubChem (CID 13214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).