C4H5Cl3 — CID 13215582
(Z)-1,1,2-trichlorobut-2-ene (PubChem CID 13215582) has the molecular formula C4H5Cl3 and a molecular weight of 159.44 g/mol. Its IUPAC name is (Z)-1,1,2-trichlorobut-2-ene.
| Compound Name | (Z)-1,1,2-trichlorobut-2-ene |
|---|---|
| PubChem CID | 13215582 |
| Molecular Formula | C4H5Cl3 |
| Molecular Weight | 159.44 g/mol |
| Exact Mass | 157.95 |
| IUPAC Name | (Z)-1,1,2-trichlorobut-2-ene |
| SMILES | C/C=C(\Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H5Cl3/c1-2-3(5)4(6)7/h2,4H,1H3/b3-2- |
| InChIKey | GTLVCKJZOABDSQ-IHWYPQMZSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|