C5H7Cl3 — CID 23263214
1,1,4-trichloropent-1-ene (PubChem CID 23263214) has the molecular formula C5H7Cl3 and a molecular weight of 173.47 g/mol. Its IUPAC name is 1,1,4-trichloropent-1-ene.
| Compound Name | 1,1,4-trichloropent-1-ene |
|---|---|
| PubChem CID | 23263214 |
| Molecular Formula | C5H7Cl3 |
| Molecular Weight | 173.47 g/mol |
| Exact Mass | 171.96 |
| IUPAC Name | 1,1,4-trichloropent-1-ene |
| SMILES | CC(Cl)CC=C(Cl)Cl |
| InChI | InChI=1S/C5H7Cl3/c1-4(6)2-3-5(7)8/h3-4H,2H2,1H3 |
| InChIKey | SDSSCYFRBRYDAS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|