About (E)-2,4-dichlorodec-4-ene
(E)-2,4-dichlorodec-4-ene (PubChem CID 23264631) has the molecular formula C10H18Cl2
and a molecular weight of 209.16 g/mol. Its IUPAC name is (E)-2,4-dichlorodec-4-ene.
Molecular Properties
| Compound Name | (E)-2,4-dichlorodec-4-ene |
| PubChem CID | 23264631 |
| Molecular Formula | C10H18Cl2 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (E)-2,4-dichlorodec-4-ene |
| SMILES | CCCCC/C=C(/Cl)CC(C)Cl |
| InChI | InChI=1S/C10H18Cl2/c1-3-4-5-6-7-10(12)8-9(2)11/h7,9H,3-6,8H2,1-2H3/b10-7+ |
| InChIKey | QWFNSPDLRLYAOP-JXMROGBWSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,4-dichlorodec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4-dichlorodec-4-ene?
The IUPAC name of (E)-2,4-dichlorodec-4-ene (CID 23264631) is (E)-2,4-dichlorodec-4-ene.
What is the SMILES notation for (E)-2,4-dichlorodec-4-ene?
The canonical SMILES for (E)-2,4-dichlorodec-4-ene is CCCCC/C=C(/Cl)CC(C)Cl.
What is the InChIKey of (E)-2,4-dichlorodec-4-ene?
The InChIKey is QWFNSPDLRLYAOP-JXMROGBWSA-N. The full InChI is InChI=1S/C10H18Cl2/c1-3-4-5-6-7-10(12)8-9(2)11/h7,9H,3-6,8H2,1-2H3/b10-7+.
What are the key properties of (E)-2,4-dichlorodec-4-ene?
(E)-2,4-dichlorodec-4-ene has a molecular weight of 209.16 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4-dichlorodec-4-ene is sourced from PubChem (CID 23264631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).