About silver 9-chlorooctadec-9-enoate
silver 9-chlorooctadec-9-enoate (PubChem CID 173443015) has the molecular formula C18H32AgClO2
and a molecular weight of 423.77 g/mol. Its IUPAC name is silver 9-chlorooctadec-9-enoate.
Molecular Properties
| Compound Name | silver 9-chlorooctadec-9-enoate |
| PubChem CID | 173443015 |
| Molecular Formula | C18H32AgClO2 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | silver 9-chlorooctadec-9-enoate |
| SMILES | CCCCCCCCC=C(Cl)CCCCCCCC(=O)[O-].[Ag+] |
| InChI | InChI=1S/C18H33ClO2.Ag/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21;/h14H,2-13,15-16H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | RYGJGOOPJOTERH-UHFFFAOYSA-M |
| XLogP | 5.34 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze silver 9-chlorooctadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 9-chlorooctadec-9-enoate?
The IUPAC name of silver 9-chlorooctadec-9-enoate (CID 173443015) is silver 9-chlorooctadec-9-enoate.
What is the SMILES notation for silver 9-chlorooctadec-9-enoate?
The canonical SMILES for silver 9-chlorooctadec-9-enoate is CCCCCCCCC=C(Cl)CCCCCCCC(=O)[O-].[Ag+].
What is the InChIKey of silver 9-chlorooctadec-9-enoate?
The InChIKey is RYGJGOOPJOTERH-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H33ClO2.Ag/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21;/h14H,2-13,15-16H2,1H3,(H,20,21);/q;+1/p-1.
What are the key properties of silver 9-chlorooctadec-9-enoate?
silver 9-chlorooctadec-9-enoate has a molecular weight of 423.77 g/mol, XLogP of 5.34, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silver 9-chlorooctadec-9-enoate is sourced from PubChem (CID 173443015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).