About iron(2+);bis((Z)-octadec-11-enoate)
iron(2+);bis((Z)-octadec-11-enoate) (PubChem CID 175691867) has the molecular formula C36H66FeO4
and a molecular weight of 618.77 g/mol. Its IUPAC name is iron(2+);bis((Z)-octadec-11-enoate).
Molecular Properties
| Compound Name | iron(2+);bis((Z)-octadec-11-enoate) |
| PubChem CID | 175691867 |
| Molecular Formula | C36H66FeO4 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | iron(2+);bis((Z)-octadec-11-enoate) |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)[O-].CCCCCC/C=C\CCCCCCCCCC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C18H34O2.Fe/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*7-8H,2-6,9-17H2,1H3,(H,19,20);/q;;+2/p-2/b2*8-7-; |
| InChIKey | GOGYGYXCBQJKGI-ATMONBRVSA-L |
| XLogP | 9.55 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis((Z)-octadec-11-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis((Z)-octadec-11-enoate)?
The IUPAC name of iron(2+);bis((Z)-octadec-11-enoate) (CID 175691867) is iron(2+);bis((Z)-octadec-11-enoate).
What is the SMILES notation for iron(2+);bis((Z)-octadec-11-enoate)?
The canonical SMILES for iron(2+);bis((Z)-octadec-11-enoate) is CCCCCC/C=C\CCCCCCCCCC(=O)[O-].CCCCCC/C=C\CCCCCCCCCC(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);bis((Z)-octadec-11-enoate)?
The InChIKey is GOGYGYXCBQJKGI-ATMONBRVSA-L. The full InChI is InChI=1S/2C18H34O2.Fe/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*7-8H,2-6,9-17H2,1H3,(H,19,20);/q;;+2/p-2/b2*8-7-;.
What are the key properties of iron(2+);bis((Z)-octadec-11-enoate)?
iron(2+);bis((Z)-octadec-11-enoate) has a molecular weight of 618.77 g/mol, XLogP of 9.55, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis((Z)-octadec-11-enoate) is sourced from PubChem (CID 175691867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).