About (Z)-1,4-dichlorodec-4-en-2-one
(Z)-1,4-dichlorodec-4-en-2-one (PubChem CID 101444851) has the molecular formula C10H16Cl2O
and a molecular weight of 223.14 g/mol. Its IUPAC name is (Z)-1,4-dichlorodec-4-en-2-one.
Molecular Properties
| Compound Name | (Z)-1,4-dichlorodec-4-en-2-one |
| PubChem CID | 101444851 |
| Molecular Formula | C10H16Cl2O |
| Molecular Weight | 223.14 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (Z)-1,4-dichlorodec-4-en-2-one |
| SMILES | CCCCC/C=C(\Cl)CC(=O)CCl |
| InChI | InChI=1S/C10H16Cl2O/c1-2-3-4-5-6-9(12)7-10(13)8-11/h6H,2-5,7-8H2,1H3/b9-6- |
| InChIKey | UCOIZCKQSCRRNP-TWGQIWQCSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.14 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,4-dichlorodec-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,4-dichlorodec-4-en-2-one?
The IUPAC name of (Z)-1,4-dichlorodec-4-en-2-one (CID 101444851) is (Z)-1,4-dichlorodec-4-en-2-one.
What is the SMILES notation for (Z)-1,4-dichlorodec-4-en-2-one?
The canonical SMILES for (Z)-1,4-dichlorodec-4-en-2-one is CCCCC/C=C(\Cl)CC(=O)CCl.
What is the InChIKey of (Z)-1,4-dichlorodec-4-en-2-one?
The InChIKey is UCOIZCKQSCRRNP-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H16Cl2O/c1-2-3-4-5-6-9(12)7-10(13)8-11/h6H,2-5,7-8H2,1H3/b9-6-.
What are the key properties of (Z)-1,4-dichlorodec-4-en-2-one?
(Z)-1,4-dichlorodec-4-en-2-one has a molecular weight of 223.14 g/mol, XLogP of 3.89, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,4-dichlorodec-4-en-2-one is sourced from PubChem (CID 101444851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).